C26H30N4O4 — CID 55767875
1-[[3-[4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoylamino]phenyl]methyl]piperidine-4-carboxamide (PubChem CID 55767875) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 1-[[3-[4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoylamino]phenyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-[[3-[4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoylamino]phenyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55767875 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 1-[[3-[4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoylamino]phenyl]methyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)Nc1cccc(CN3CCC(C(N)=O)CC3)c1)C2=O |
| InChI | InChI=1S/C26H30N4O4/c1-17-7-8-21-22(14-17)26(34)30(25(21)33)11-3-6-23(31)28-20-5-2-4-18(15-20)16-29-12-9-19(10-13-29)24(27)32/h2,4-5,7-8,14-15,19H,3,6,9-13,16H2,1H3,(H2,27,32)(H,28,31) |
| InChIKey | HSHWUQSFTOLQTI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|