C22H19FN4O3 — CID 55855859
N-(3-fluoro-4-imidazol-1-ylphenyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 55855859) has the molecular formula C22H19FN4O3 and a molecular weight of 406.42 g/mol. Its IUPAC name is N-(3-fluoro-4-imidazol-1-ylphenyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-(3-fluoro-4-imidazol-1-ylphenyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 55855859 |
| Molecular Formula | C22H19FN4O3 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-(3-fluoro-4-imidazol-1-ylphenyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)Nc1ccc(-n3ccnc3)c(F)c1)C2=O |
| InChI | InChI=1S/C22H19FN4O3/c1-14-4-6-16-17(11-14)22(30)27(21(16)29)9-2-3-20(28)25-15-5-7-19(18(23)12-15)26-10-8-24-13-26/h4-8,10-13H,2-3,9H2,1H3,(H,25,28) |
| InChIKey | ASWDDEJAOFALSN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|