C21H16FN3OS — CID 60557245
N-(3-fluoro-4-imidazol-1-ylphenyl)-3-(4-methylphenyl)thiophene-2-carboxamide (PubChem CID 60557245) has the molecular formula C21H16FN3OS and a molecular weight of 377.44 g/mol. Its IUPAC name is N-(3-fluoro-4-imidazol-1-ylphenyl)-3-(4-methylphenyl)thiophene-2-carboxamide.
| Compound Name | N-(3-fluoro-4-imidazol-1-ylphenyl)-3-(4-methylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 60557245 |
| Molecular Formula | C21H16FN3OS |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-(3-fluoro-4-imidazol-1-ylphenyl)-3-(4-methylphenyl)thiophene-2-carboxamide |
| SMILES | Cc1ccc(-c2ccsc2C(=O)Nc2ccc(-n3ccnc3)c(F)c2)cc1 |
| InChI | InChI=1S/C21H16FN3OS/c1-14-2-4-15(5-3-14)17-8-11-27-20(17)21(26)24-16-6-7-19(18(22)12-16)25-10-9-23-13-25/h2-13H,1H3,(H,24,26) |
| InChIKey | PUSXXNHAGVOZGM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |