C17H27N3O5S2 — CID 108558943
tert-butyl N-[3-oxo-3-[(1-thiophen-2-ylsulfonylpiperidin-4-yl)amino]propyl]carbamate (PubChem CID 108558943) has the molecular formula C17H27N3O5S2 and a molecular weight of 417.55 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[(1-thiophen-2-ylsulfonylpiperidin-4-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[(1-thiophen-2-ylsulfonylpiperidin-4-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 108558943 |
| Molecular Formula | C17H27N3O5S2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[(1-thiophen-2-ylsulfonylpiperidin-4-yl)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NC1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C17H27N3O5S2/c1-17(2,3)25-16(22)18-9-6-14(21)19-13-7-10-20(11-8-13)27(23,24)15-5-4-12-26-15/h4-5,12-13H,6-11H2,1-3H3,(H,18,22)(H,19,21) |
| InChIKey | GHAPKYRZEWLXQK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |