C24H23FN2O — CID 42697826
1-(4-ethylphenyl)-3-(3-fluorophenyl)-1-[(E)-3-phenylprop-2-enyl]urea (PubChem CID 42697826) has the molecular formula C24H23FN2O and a molecular weight of 374.46 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-(3-fluorophenyl)-1-[(E)-3-phenylprop-2-enyl]urea.
| Compound Name | 1-(4-ethylphenyl)-3-(3-fluorophenyl)-1-[(E)-3-phenylprop-2-enyl]urea |
|---|---|
| PubChem CID | 42697826 |
| Molecular Formula | C24H23FN2O |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 1-(4-ethylphenyl)-3-(3-fluorophenyl)-1-[(E)-3-phenylprop-2-enyl]urea |
| SMILES | CCc1ccc(N(C/C=C/c2ccccc2)C(=O)Nc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C24H23FN2O/c1-2-19-13-15-23(16-14-19)27(17-7-10-20-8-4-3-5-9-20)24(28)26-22-12-6-11-21(25)18-22/h3-16,18H,2,17H2,1H3,(H,26,28)/b10-7+ |
| InChIKey | VKRQBBFWSLRRBP-JXMROGBWSA-N |
| XLogP | 6.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |