C23H30N2O2 — CID 42704591
N-[2-(octanoylamino)ethyl]-N-phenylbenzamide (PubChem CID 42704591) has the molecular formula C23H30N2O2 and a molecular weight of 366.50 g/mol. Its IUPAC name is N-[2-(octanoylamino)ethyl]-N-phenylbenzamide.
| Compound Name | N-[2-(octanoylamino)ethyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 42704591 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-[2-(octanoylamino)ethyl]-N-phenylbenzamide |
| SMILES | CCCCCCCC(=O)NCCN(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O2/c1-2-3-4-5-12-17-22(26)24-18-19-25(21-15-10-7-11-16-21)23(27)20-13-8-6-9-14-20/h6-11,13-16H,2-5,12,17-19H2,1H3,(H,24,26) |
| InChIKey | JQJKKEWFOZNRQL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|