C24H24FN3O4 — CID 42724477
N-(4-fluorophenyl)-4-methoxy-N-[2-[(2-methoxyphenyl)carbamoylamino]ethyl]benzamide (PubChem CID 42724477) has the molecular formula C24H24FN3O4 and a molecular weight of 437.47 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-methoxy-N-[2-[(2-methoxyphenyl)carbamoylamino]ethyl]benzamide.
| Compound Name | N-(4-fluorophenyl)-4-methoxy-N-[2-[(2-methoxyphenyl)carbamoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 42724477 |
| Molecular Formula | C24H24FN3O4 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-(4-fluorophenyl)-4-methoxy-N-[2-[(2-methoxyphenyl)carbamoylamino]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)N(CCNC(=O)Nc2ccccc2OC)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H24FN3O4/c1-31-20-13-7-17(8-14-20)23(29)28(19-11-9-18(25)10-12-19)16-15-26-24(30)27-21-5-3-4-6-22(21)32-2/h3-14H,15-16H2,1-2H3,(H2,26,27,30) |
| InChIKey | PPXTUZXGDQLYQF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |