C23H29FN4O2 — CID 42704537
1-[3-(cyclohexylcarbamoylamino)propyl]-1-(4-fluorophenyl)-3-phenylurea (PubChem CID 42704537) has the molecular formula C23H29FN4O2 and a molecular weight of 412.51 g/mol. Its IUPAC name is 1-[3-(cyclohexylcarbamoylamino)propyl]-1-(4-fluorophenyl)-3-phenylurea.
| Compound Name | 1-[3-(cyclohexylcarbamoylamino)propyl]-1-(4-fluorophenyl)-3-phenylurea |
|---|---|
| PubChem CID | 42704537 |
| Molecular Formula | C23H29FN4O2 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 1-[3-(cyclohexylcarbamoylamino)propyl]-1-(4-fluorophenyl)-3-phenylurea |
| SMILES | O=C(NCCCN(C(=O)Nc1ccccc1)c1ccc(F)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C23H29FN4O2/c24-18-12-14-21(15-13-18)28(23(30)27-20-10-5-2-6-11-20)17-7-16-25-22(29)26-19-8-3-1-4-9-19/h2,5-6,10-15,19H,1,3-4,7-9,16-17H2,(H,27,30)(H2,25,26,29) |
| InChIKey | DQCNEPQMOPDIGW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|