C25H43O5P — CID 10253453
1-(3,5-ditert-butyl-4-methoxyphenyl)-4-dimethoxyphosphoryl-4-ethylhexan-3-one (PubChem CID 10253453) has the molecular formula C25H43O5P and a molecular weight of 454.59 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-methoxyphenyl)-4-dimethoxyphosphoryl-4-ethylhexan-3-one.
| Compound Name | 1-(3,5-ditert-butyl-4-methoxyphenyl)-4-dimethoxyphosphoryl-4-ethylhexan-3-one |
|---|---|
| PubChem CID | 10253453 |
| Molecular Formula | C25H43O5P |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-methoxyphenyl)-4-dimethoxyphosphoryl-4-ethylhexan-3-one |
| SMILES | CCC(CC)(C(=O)CCc1cc(C(C)(C)C)c(OC)c(C(C)(C)C)c1)P(=O)(OC)OC |
| InChI | InChI=1S/C25H43O5P/c1-12-25(13-2,31(27,29-10)30-11)21(26)15-14-18-16-19(23(3,4)5)22(28-9)20(17-18)24(6,7)8/h16-17H,12-15H2,1-11H3 |
| InChIKey | UDTYJRGKZRBMRP-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|