C17H28NO4P — CID 175356986
[4-(3-amino-3-oxopropyl)-2,6-ditert-butylphenyl] dihydrogen phosphite (PubChem CID 175356986) has the molecular formula C17H28NO4P and a molecular weight of 341.39 g/mol. Its IUPAC name is [4-(3-amino-3-oxopropyl)-2,6-ditert-butylphenyl] dihydrogen phosphite.
| Compound Name | [4-(3-amino-3-oxopropyl)-2,6-ditert-butylphenyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 175356986 |
| Molecular Formula | C17H28NO4P |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | [4-(3-amino-3-oxopropyl)-2,6-ditert-butylphenyl] dihydrogen phosphite |
| SMILES | CC(C)(C)c1cc(CCC(N)=O)cc(C(C)(C)C)c1OP(O)O |
| InChI | InChI=1S/C17H28NO4P/c1-16(2,3)12-9-11(7-8-14(18)19)10-13(17(4,5)6)15(12)22-23(20)21/h9-10,20-21H,7-8H2,1-6H3,(H2,18,19) |
| InChIKey | ZEMQFHADGGSZOK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|