C23H38N2O7 — CID 67351832
ethyl acetate;2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2-[4-(4-aminobutyl)phenoxy]acetate (PubChem CID 67351832) has the molecular formula C23H38N2O7 and a molecular weight of 454.56 g/mol. Its IUPAC name is ethyl acetate;2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2-[4-(4-aminobutyl)phenoxy]acetate.
| Compound Name | ethyl acetate;2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2-[4-(4-aminobutyl)phenoxy]acetate |
|---|---|
| PubChem CID | 67351832 |
| Molecular Formula | C23H38N2O7 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | ethyl acetate;2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2-[4-(4-aminobutyl)phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)NCCOC(=O)COc1ccc(CCCCN)cc1.CCOC(C)=O |
| InChI | InChI=1S/C19H30N2O5.C4H8O2/c1-19(2,3)26-18(23)21-12-13-24-17(22)14-25-16-9-7-15(8-10-16)6-4-5-11-20;1-3-6-4(2)5/h7-10H,4-6,11-14,20H2,1-3H3,(H,21,23);3H2,1-2H3 |
| InChIKey | MWLQUXHOJWXLMP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|