C18H30N2O6 — CID 135207377
tert-butyl N-(4-aminobutyl)carbamate;2-[4-(hydroxymethyl)phenoxy]acetic acid (PubChem CID 135207377) has the molecular formula C18H30N2O6 and a molecular weight of 370.45 g/mol. Its IUPAC name is tert-butyl N-(4-aminobutyl)carbamate;2-[4-(hydroxymethyl)phenoxy]acetic acid.
| Compound Name | tert-butyl N-(4-aminobutyl)carbamate;2-[4-(hydroxymethyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 135207377 |
| Molecular Formula | C18H30N2O6 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | tert-butyl N-(4-aminobutyl)carbamate;2-[4-(hydroxymethyl)phenoxy]acetic acid |
| SMILES | CC(C)(C)OC(=O)NCCCCN.O=C(O)COc1ccc(CO)cc1 |
| InChI | InChI=1S/C9H20N2O2.C9H10O4/c1-9(2,3)13-8(12)11-7-5-4-6-10;10-5-7-1-3-8(4-2-7)13-6-9(11)12/h4-7,10H2,1-3H3,(H,11,12);1-4,10H,5-6H2,(H,11,12) |
| InChIKey | QZXCLPLMBKZCTE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|