C12H21N3O5 — CID 123875399
ethyl 3-acetamido-2-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]propanoate (PubChem CID 123875399) has the molecular formula C12H21N3O5 and a molecular weight of 287.32 g/mol. Its IUPAC name is ethyl 3-acetamido-2-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]propanoate.
| Compound Name | ethyl 3-acetamido-2-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]propanoate |
|---|---|
| PubChem CID | 123875399 |
| Molecular Formula | C12H21N3O5 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | ethyl 3-acetamido-2-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]propanoate |
| SMILES | CCOC(=O)C(CNC(C)=O)=NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21N3O5/c1-6-19-10(17)9(7-13-8(2)16)14-15-11(18)20-12(3,4)5/h6-7H2,1-5H3,(H,13,16)(H,15,18) |
| InChIKey | OARGHAULYFXXHP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|