C15H22N2O2 — CID 9074587
tert-butyl N-[(Z)-1-(4-methylphenyl)propylideneamino]carbamate (PubChem CID 9074587) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is tert-butyl N-[(Z)-1-(4-methylphenyl)propylideneamino]carbamate.
| Compound Name | tert-butyl N-[(Z)-1-(4-methylphenyl)propylideneamino]carbamate |
|---|---|
| PubChem CID | 9074587 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | tert-butyl N-[(Z)-1-(4-methylphenyl)propylideneamino]carbamate |
| SMILES | CC/C(=N/NC(=O)OC(C)(C)C)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H22N2O2/c1-6-13(12-9-7-11(2)8-10-12)16-17-14(18)19-15(3,4)5/h7-10H,6H2,1-5H3,(H,17,18)/b16-13- |
| InChIKey | CQLNZPGHXYRCKK-SSZFMOIBSA-N |
| XLogP | 3.63 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|