C12H18N2O2S — CID 8972522
tert-butyl N-[(Z)-1-thiophen-2-ylpropylideneamino]carbamate (PubChem CID 8972522) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is tert-butyl N-[(Z)-1-thiophen-2-ylpropylideneamino]carbamate.
| Compound Name | tert-butyl N-[(Z)-1-thiophen-2-ylpropylideneamino]carbamate |
|---|---|
| PubChem CID | 8972522 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | tert-butyl N-[(Z)-1-thiophen-2-ylpropylideneamino]carbamate |
| SMILES | CC/C(=N/NC(=O)OC(C)(C)C)c1cccs1 |
| InChI | InChI=1S/C12H18N2O2S/c1-5-9(10-7-6-8-17-10)13-14-11(15)16-12(2,3)4/h6-8H,5H2,1-4H3,(H,14,15)/b13-9- |
| InChIKey | PUYHUQIDNRDNMV-LCYFTJDESA-N |
| XLogP | 3.39 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|