C19H29N3O7S — CID 15458135
(2E)-2-[1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yloxyimino]-2-thiophen-2-ylacetic acid (PubChem CID 15458135) has the molecular formula C19H29N3O7S and a molecular weight of 443.52 g/mol. Its IUPAC name is (2E)-2-[1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yloxyimino]-2-thiophen-2-ylacetic acid.
| Compound Name | (2E)-2-[1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yloxyimino]-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 15458135 |
| Molecular Formula | C19H29N3O7S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | (2E)-2-[1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yloxyimino]-2-thiophen-2-ylacetic acid |
| SMILES | CC(C)(C)OC(=O)NCC(CNC(=O)OC(C)(C)C)O/N=C(\C(=O)O)c1cccs1 |
| InChI | InChI=1S/C19H29N3O7S/c1-18(2,3)27-16(25)20-10-12(11-21-17(26)28-19(4,5)6)29-22-14(15(23)24)13-8-7-9-30-13/h7-9,12H,10-11H2,1-6H3,(H,20,25)(H,21,26)(H,23,24)/b22-14- |
| InChIKey | ISSVOTIRFBCREQ-HMAPJEAMSA-N |
| XLogP | 2.97 |
| TPSA | 135.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|