C15H20F3N3O2 — CID 140870852
tert-butyl N-[1-[4-(trifluoromethyl)anilino]propan-2-ylideneamino]carbamate (PubChem CID 140870852) has the molecular formula C15H20F3N3O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(trifluoromethyl)anilino]propan-2-ylideneamino]carbamate.
| Compound Name | tert-butyl N-[1-[4-(trifluoromethyl)anilino]propan-2-ylideneamino]carbamate |
|---|---|
| PubChem CID | 140870852 |
| Molecular Formula | C15H20F3N3O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | tert-butyl N-[1-[4-(trifluoromethyl)anilino]propan-2-ylideneamino]carbamate |
| SMILES | CC(CNc1ccc(C(F)(F)F)cc1)=NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H20F3N3O2/c1-10(20-21-13(22)23-14(2,3)4)9-19-12-7-5-11(6-8-12)15(16,17)18/h5-8,19H,9H2,1-4H3,(H,21,22) |
| InChIKey | CKJXJVDLNSPVEJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|