C17H25F3IN3O2 — CID 111783977
tert-butyl 2-[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]acetate;hydroiodide (PubChem CID 111783977) has the molecular formula C17H25F3IN3O2 and a molecular weight of 487.30 g/mol. Its IUPAC name is tert-butyl 2-[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]acetate;hydroiodide.
| Compound Name | tert-butyl 2-[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]acetate;hydroiodide |
|---|---|
| PubChem CID | 111783977 |
| Molecular Formula | C17H25F3IN3O2 |
| Molecular Weight | 487.30 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | tert-butyl 2-[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]acetate;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(C(F)(F)F)cc1)NCC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C17H24F3N3O2.HI/c1-16(2,3)25-14(24)11-23-15(21-4)22-10-9-12-5-7-13(8-6-12)17(18,19)20;/h5-8H,9-11H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | LOHPKOMVXTWAKJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|