C16H20F6N4O — CID 111500807
N-methyl-2-[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 111500807) has the molecular formula C16H20F6N4O and a molecular weight of 398.35 g/mol. Its IUPAC name is N-methyl-2-[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | N-methyl-2-[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 111500807 |
| Molecular Formula | C16H20F6N4O |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-methyl-2-[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | C/N=C(/NCCc1ccc(C(F)(F)F)cc1)NCC(=O)N(C)CC(F)(F)F |
| InChI | InChI=1S/C16H20F6N4O/c1-23-14(25-9-13(27)26(2)10-15(17,18)19)24-8-7-11-3-5-12(6-4-11)16(20,21)22/h3-6H,7-10H2,1-2H3,(H2,23,24,25) |
| InChIKey | SCJPEPPBLYHUFL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|