C16H23F3N4O3 — CID 111501645
2-[[N-[2-(4-methoxyphenoxy)ethyl]-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 111501645) has the molecular formula C16H23F3N4O3 and a molecular weight of 376.38 g/mol. Its IUPAC name is 2-[[N-[2-(4-methoxyphenoxy)ethyl]-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[N-[2-(4-methoxyphenoxy)ethyl]-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 111501645 |
| Molecular Formula | C16H23F3N4O3 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-[[N-[2-(4-methoxyphenoxy)ethyl]-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | C/N=C(/NCCOc1ccc(OC)cc1)NCC(=O)N(C)CC(F)(F)F |
| InChI | InChI=1S/C16H23F3N4O3/c1-20-15(22-10-14(24)23(2)11-16(17,18)19)21-8-9-26-13-6-4-12(25-3)5-7-13/h4-7H,8-11H2,1-3H3,(H2,20,21,22) |
| InChIKey | IVOMNMHTYRZXAB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|