C16H23F4IN4O2 — CID 111501716
2-[[N-[2-(4-fluorophenoxy)ethyl]-N,N'-dimethylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide (PubChem CID 111501716) has the molecular formula C16H23F4IN4O2 and a molecular weight of 506.28 g/mol. Its IUPAC name is 2-[[N-[2-(4-fluorophenoxy)ethyl]-N,N'-dimethylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-[2-(4-fluorophenoxy)ethyl]-N,N'-dimethylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111501716 |
| Molecular Formula | C16H23F4IN4O2 |
| Molecular Weight | 506.28 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 2-[[N-[2-(4-fluorophenoxy)ethyl]-N,N'-dimethylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)N(C)CC(F)(F)F)N(C)CCOc1ccc(F)cc1.I |
| InChI | InChI=1S/C16H22F4N4O2.HI/c1-21-15(22-10-14(25)24(3)11-16(18,19)20)23(2)8-9-26-13-6-4-12(17)5-7-13;/h4-7H,8-11H2,1-3H3,(H,21,22);1H |
| InChIKey | FPPGATDMGVTDAT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|