C15H19Cl3F3IN4O2 — CID 109464223
N-methyl-2-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide (PubChem CID 109464223) has the molecular formula C15H19Cl3F3IN4O2 and a molecular weight of 577.60 g/mol. Its IUPAC name is N-methyl-2-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide.
| Compound Name | N-methyl-2-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 109464223 |
| Molecular Formula | C15H19Cl3F3IN4O2 |
| Molecular Weight | 577.60 g/mol |
| Exact Mass | 575.96 |
| IUPAC Name | N-methyl-2-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
| SMILES | C/N=C(/NCCOc1c(Cl)cc(Cl)cc1Cl)NCC(=O)N(C)CC(F)(F)F.I |
| InChI | InChI=1S/C15H18Cl3F3N4O2.HI/c1-22-14(24-7-12(26)25(2)8-15(19,20)21)23-3-4-27-13-10(17)5-9(16)6-11(13)18;/h5-6H,3-4,7-8H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | HBZWJFOJBJLUJT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|