C14H22Cl3IN4O3S — CID 109464291
1-[2-(ethylsulfonylamino)ethyl]-2-methyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide (PubChem CID 109464291) has the molecular formula C14H22Cl3IN4O3S and a molecular weight of 559.69 g/mol. Its IUPAC name is 1-[2-(ethylsulfonylamino)ethyl]-2-methyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(ethylsulfonylamino)ethyl]-2-methyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109464291 |
| Molecular Formula | C14H22Cl3IN4O3S |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 557.95 |
| IUPAC Name | 1-[2-(ethylsulfonylamino)ethyl]-2-methyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide |
| SMILES | CCS(=O)(=O)NCCN/C(=N\C)NCCOc1c(Cl)cc(Cl)cc1Cl.I |
| InChI | InChI=1S/C14H21Cl3N4O3S.HI/c1-3-25(22,23)21-5-4-19-14(18-2)20-6-7-24-13-11(16)8-10(15)9-12(13)17;/h8-9,21H,3-7H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | QLGJNUJWTIBDRP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|