C16H24Cl3IN4O2 — CID 109464273
N,2,2-trimethyl-3-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 109464273) has the molecular formula C16H24Cl3IN4O2 and a molecular weight of 537.66 g/mol. Its IUPAC name is N,2,2-trimethyl-3-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N,2,2-trimethyl-3-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 109464273 |
| Molecular Formula | C16H24Cl3IN4O2 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 536.00 |
| IUPAC Name | N,2,2-trimethyl-3-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(/NCCOc1c(Cl)cc(Cl)cc1Cl)NCC(C)(C)C(=O)NC.I |
| InChI | InChI=1S/C16H23Cl3N4O2.HI/c1-16(2,14(24)20-3)9-23-15(21-4)22-5-6-25-13-11(18)7-10(17)8-12(13)19;/h7-8H,5-6,9H2,1-4H3,(H,20,24)(H2,21,22,23);1H |
| InChIKey | BBLWGZLELZDIEC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|