C12H15Cl3F2IN3O — CID 109464313
1-(2,2-difluoroethyl)-2-methyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide (PubChem CID 109464313) has the molecular formula C12H15Cl3F2IN3O and a molecular weight of 488.53 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-2-methyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(2,2-difluoroethyl)-2-methyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109464313 |
| Molecular Formula | C12H15Cl3F2IN3O |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 486.93 |
| IUPAC Name | 1-(2,2-difluoroethyl)-2-methyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCOc1c(Cl)cc(Cl)cc1Cl)NCC(F)F.I |
| InChI | InChI=1S/C12H14Cl3F2N3O.HI/c1-18-12(20-6-10(16)17)19-2-3-21-11-8(14)4-7(13)5-9(11)15;/h4-5,10H,2-3,6H2,1H3,(H2,18,19,20);1H |
| InChIKey | UURXZVJQWFDMAY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|