C15H22Cl3IN4O3 — CID 109464279
N-(2-methoxyethyl)-2-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 109464279) has the molecular formula C15H22Cl3IN4O3 and a molecular weight of 539.63 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-(2-methoxyethyl)-2-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 109464279 |
| Molecular Formula | C15H22Cl3IN4O3 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 537.98 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(/NCCOc1c(Cl)cc(Cl)cc1Cl)NCC(=O)NCCOC.I |
| InChI | InChI=1S/C15H21Cl3N4O3.HI/c1-19-15(22-9-13(23)20-3-5-24-2)21-4-6-25-14-11(17)7-10(16)8-12(14)18;/h7-8H,3-6,9H2,1-2H3,(H,20,23)(H2,19,21,22);1H |
| InChIKey | CPMOGXUVTHYWRA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|