C18H28Cl3N5O — CID 109464252
1-[2-(4-ethylpiperazin-1-yl)ethyl]-2-methyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine (PubChem CID 109464252) has the molecular formula C18H28Cl3N5O and a molecular weight of 436.82 g/mol. Its IUPAC name is 1-[2-(4-ethylpiperazin-1-yl)ethyl]-2-methyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine.
| Compound Name | 1-[2-(4-ethylpiperazin-1-yl)ethyl]-2-methyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 109464252 |
| Molecular Formula | C18H28Cl3N5O |
| Molecular Weight | 436.82 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 1-[2-(4-ethylpiperazin-1-yl)ethyl]-2-methyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine |
| SMILES | CCN1CCN(CCN/C(=N\C)NCCOc2c(Cl)cc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C18H28Cl3N5O/c1-3-25-7-9-26(10-8-25)6-4-23-18(22-2)24-5-11-27-17-15(20)12-14(19)13-16(17)21/h12-13H,3-11H2,1-2H3,(H2,22,23,24) |
| InChIKey | NIFFGSRTIOVROT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.82 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|