C16H19Cl3N6O — CID 109464322
1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine (PubChem CID 109464322) has the molecular formula C16H19Cl3N6O and a molecular weight of 417.73 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine.
| Compound Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 109464322 |
| Molecular Formula | C16H19Cl3N6O |
| Molecular Weight | 417.73 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine |
| SMILES | C/N=C(\NCCOc1c(Cl)cc(Cl)cc1Cl)NCc1nnc2n1CCC2 |
| InChI | InChI=1S/C16H19Cl3N6O/c1-20-16(22-9-14-24-23-13-3-2-5-25(13)14)21-4-6-26-15-11(18)7-10(17)8-12(15)19/h7-8H,2-6,9H2,1H3,(H2,20,21,22) |
| InChIKey | ZXKDVNGXQFDRQX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.73 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|