C19H28N6O — CID 111020529
1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-[3-(1-phenylethoxy)propyl]guanidine (PubChem CID 111020529) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-[3-(1-phenylethoxy)propyl]guanidine.
| Compound Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-[3-(1-phenylethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111020529 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-[3-(1-phenylethoxy)propyl]guanidine |
| SMILES | C/N=C(\NCCCOC(C)c1ccccc1)NCc1nnc2n1CCC2 |
| InChI | InChI=1S/C19H28N6O/c1-15(16-8-4-3-5-9-16)26-13-7-11-21-19(20-2)22-14-18-24-23-17-10-6-12-25(17)18/h3-5,8-9,15H,6-7,10-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | ICPGLKFLPBIHIW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|