C15H21Cl3N4O2 — CID 109464234
2-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]-N-propylacetamide (PubChem CID 109464234) has the molecular formula C15H21Cl3N4O2 and a molecular weight of 395.72 g/mol. Its IUPAC name is 2-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]-N-propylacetamide.
| Compound Name | 2-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]-N-propylacetamide |
|---|---|
| PubChem CID | 109464234 |
| Molecular Formula | C15H21Cl3N4O2 |
| Molecular Weight | 395.72 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN/C(=N\C)NCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C15H21Cl3N4O2/c1-3-4-20-13(23)9-22-15(19-2)21-5-6-24-14-11(17)7-10(16)8-12(14)18/h7-8H,3-6,9H2,1-2H3,(H,20,23)(H2,19,21,22) |
| InChIKey | XSJHYERFCPNXBW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.72 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|