C18H21Cl3IN5O2 — CID 109464429
N-[2-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]ethyl]pyridine-3-carboxamide;hydroiodide (PubChem CID 109464429) has the molecular formula C18H21Cl3IN5O2 and a molecular weight of 572.66 g/mol. Its IUPAC name is N-[2-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]ethyl]pyridine-3-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]ethyl]pyridine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 109464429 |
| Molecular Formula | C18H21Cl3IN5O2 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 570.98 |
| IUPAC Name | N-[2-[[N'-methyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamimidoyl]amino]ethyl]pyridine-3-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1cccnc1)NCCOc1c(Cl)cc(Cl)cc1Cl.I |
| InChI | InChI=1S/C18H20Cl3N5O2.HI/c1-22-18(25-6-5-24-17(27)12-3-2-4-23-11-12)26-7-8-28-16-14(20)9-13(19)10-15(16)21;/h2-4,9-11H,5-8H2,1H3,(H,24,27)(H2,22,25,26);1H |
| InChIKey | VIBFWYWKMKEFBU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|