C18H19N5O3 — CID 78460789
N-(4-methylphenyl)-N'-[[4-oxo-4-(pyridin-3-ylamino)butan-2-ylidene]amino]oxamide (PubChem CID 78460789) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is N-(4-methylphenyl)-N'-[[4-oxo-4-(pyridin-3-ylamino)butan-2-ylidene]amino]oxamide.
| Compound Name | N-(4-methylphenyl)-N'-[[4-oxo-4-(pyridin-3-ylamino)butan-2-ylidene]amino]oxamide |
|---|---|
| PubChem CID | 78460789 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-(4-methylphenyl)-N'-[[4-oxo-4-(pyridin-3-ylamino)butan-2-ylidene]amino]oxamide |
| SMILES | CC(CC(=O)Nc1cccnc1)=NNC(=O)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C18H19N5O3/c1-12-5-7-14(8-6-12)21-17(25)18(26)23-22-13(2)10-16(24)20-15-4-3-9-19-11-15/h3-9,11H,10H2,1-2H3,(H,20,24)(H,21,25)(H,23,26) |
| InChIKey | MYKZSTMRTUGRFT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|