C26H35N3O3 — CID 17480900
3-acetamido-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]adamantane-1-carboxamide (PubChem CID 17480900) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 3-acetamido-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]adamantane-1-carboxamide.
| Compound Name | 3-acetamido-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 17480900 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 3-acetamido-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]adamantane-1-carboxamide |
| SMILES | CC(=O)NC12CC3CC(C1)CC(C(=O)NCc1ccc(C(=O)N4CCCCC4)cc1)(C3)C2 |
| InChI | InChI=1S/C26H35N3O3/c1-18(30)28-26-14-20-11-21(15-26)13-25(12-20,17-26)24(32)27-16-19-5-7-22(8-6-19)23(31)29-9-3-2-4-10-29/h5-8,20-21H,2-4,9-17H2,1H3,(H,27,32)(H,28,30) |
| InChIKey | VRQAFPZDNMCTLZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |