C23H31N3O4 — CID 25495003
(5S,7R)-3-acetamido-N-[1-(furan-2-carbonyl)piperidin-4-yl]adamantane-1-carboxamide (PubChem CID 25495003) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is (5S,7R)-3-acetamido-N-[1-(furan-2-carbonyl)piperidin-4-yl]adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-acetamido-N-[1-(furan-2-carbonyl)piperidin-4-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 25495003 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | (5S,7R)-3-acetamido-N-[1-(furan-2-carbonyl)piperidin-4-yl]adamantane-1-carboxamide |
| SMILES | CC(=O)NC12C[C@H]3C[C@@H](C1)CC(C(=O)NC1CCN(C(=O)c4ccco4)CC1)(C3)C2 |
| InChI | InChI=1S/C23H31N3O4/c1-15(27)25-23-12-16-9-17(13-23)11-22(10-16,14-23)21(29)24-18-4-6-26(7-5-18)20(28)19-3-2-8-30-19/h2-3,8,16-18H,4-7,9-14H2,1H3,(H,24,29)(H,25,27)/t16-,17+,22?,23? |
| InChIKey | JNBNDTHAZARZFG-WDXRGRCHSA-N |
| XLogP | 2.48 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |