C22H30N2O4 — CID 18146151
N-[1-(furan-2-carbonyl)piperidin-4-yl]-2-(3-hydroxy-1-adamantyl)acetamide (PubChem CID 18146151) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is N-[1-(furan-2-carbonyl)piperidin-4-yl]-2-(3-hydroxy-1-adamantyl)acetamide.
| Compound Name | N-[1-(furan-2-carbonyl)piperidin-4-yl]-2-(3-hydroxy-1-adamantyl)acetamide |
|---|---|
| PubChem CID | 18146151 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | N-[1-(furan-2-carbonyl)piperidin-4-yl]-2-(3-hydroxy-1-adamantyl)acetamide |
| SMILES | O=C(CC12CC3CC(CC(O)(C3)C1)C2)NC1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C22H30N2O4/c25-19(13-21-9-15-8-16(10-21)12-22(27,11-15)14-21)23-17-3-5-24(6-4-17)20(26)18-2-1-7-28-18/h1-2,7,15-17,27H,3-6,8-14H2,(H,23,25) |
| InChIKey | BZEDQMIAYDOVFY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |