C19H30ClN3O3 — CID 119700558
N-[1-(furan-2-carbonyl)piperidin-4-yl]-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119700558) has the molecular formula C19H30ClN3O3 and a molecular weight of 383.92 g/mol. Its IUPAC name is N-[1-(furan-2-carbonyl)piperidin-4-yl]-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-[1-(furan-2-carbonyl)piperidin-4-yl]-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119700558 |
| Molecular Formula | C19H30ClN3O3 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[1-(furan-2-carbonyl)piperidin-4-yl]-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)NC1CCN(C(=O)c2ccco2)CC1)C1CCNCC1.Cl |
| InChI | InChI=1S/C19H29N3O3.ClH/c1-14(15-4-8-20-9-5-15)13-18(23)21-16-6-10-22(11-7-16)19(24)17-3-2-12-25-17;/h2-3,12,14-16,20H,4-11,13H2,1H3,(H,21,23);1H |
| InChIKey | BWWNEFFIBDHZRT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |