C20H24N2O4 — CID 18149409
N-[1-(furan-2-carbonyl)piperidin-4-yl]-3-(4-methoxyphenyl)propanamide (PubChem CID 18149409) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is N-[1-(furan-2-carbonyl)piperidin-4-yl]-3-(4-methoxyphenyl)propanamide.
| Compound Name | N-[1-(furan-2-carbonyl)piperidin-4-yl]-3-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 18149409 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-[1-(furan-2-carbonyl)piperidin-4-yl]-3-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)NC2CCN(C(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C20H24N2O4/c1-25-17-7-4-15(5-8-17)6-9-19(23)21-16-10-12-22(13-11-16)20(24)18-3-2-14-26-18/h2-5,7-8,14,16H,6,9-13H2,1H3,(H,21,23) |
| InChIKey | FOPHNTNBWNCOQJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |