C21H26N2O5 — CID 46539288
3-(2,5-dimethoxyphenyl)-N-[1-(furan-2-carbonyl)piperidin-4-yl]propanamide (PubChem CID 46539288) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-N-[1-(furan-2-carbonyl)piperidin-4-yl]propanamide.
| Compound Name | 3-(2,5-dimethoxyphenyl)-N-[1-(furan-2-carbonyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 46539288 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-N-[1-(furan-2-carbonyl)piperidin-4-yl]propanamide |
| SMILES | COc1ccc(OC)c(CCC(=O)NC2CCN(C(=O)c3ccco3)CC2)c1 |
| InChI | InChI=1S/C21H26N2O5/c1-26-17-6-7-18(27-2)15(14-17)5-8-20(24)22-16-9-11-23(12-10-16)21(25)19-4-3-13-28-19/h3-4,6-7,13-14,16H,5,8-12H2,1-2H3,(H,22,24) |
| InChIKey | XUYGNPOFAWZPJX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |