C24H41Cl2N3O — CID 119862946
N-[1-(4-tert-butylphenyl)piperidin-4-yl]-3-piperidin-4-ylbutanamide;dihydrochloride (PubChem CID 119862946) has the molecular formula C24H41Cl2N3O and a molecular weight of 458.52 g/mol. Its IUPAC name is N-[1-(4-tert-butylphenyl)piperidin-4-yl]-3-piperidin-4-ylbutanamide;dihydrochloride.
| Compound Name | N-[1-(4-tert-butylphenyl)piperidin-4-yl]-3-piperidin-4-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119862946 |
| Molecular Formula | C24H41Cl2N3O |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | N-[1-(4-tert-butylphenyl)piperidin-4-yl]-3-piperidin-4-ylbutanamide;dihydrochloride |
| SMILES | CC(CC(=O)NC1CCN(c2ccc(C(C)(C)C)cc2)CC1)C1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C24H39N3O.2ClH/c1-18(19-9-13-25-14-10-19)17-23(28)26-21-11-15-27(16-12-21)22-7-5-20(6-8-22)24(2,3)4;;/h5-8,18-19,21,25H,9-17H2,1-4H3,(H,26,28);2*1H |
| InChIKey | UQAZOTGNSBDLDJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |