C24H35Cl2N3O — CID 119953381
3-amino-N-[1-(4-tert-butylphenyl)piperidin-4-yl]-3-phenylpropanamide;dihydrochloride (PubChem CID 119953381) has the molecular formula C24H35Cl2N3O and a molecular weight of 452.47 g/mol. Its IUPAC name is 3-amino-N-[1-(4-tert-butylphenyl)piperidin-4-yl]-3-phenylpropanamide;dihydrochloride.
| Compound Name | 3-amino-N-[1-(4-tert-butylphenyl)piperidin-4-yl]-3-phenylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 119953381 |
| Molecular Formula | C24H35Cl2N3O |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 3-amino-N-[1-(4-tert-butylphenyl)piperidin-4-yl]-3-phenylpropanamide;dihydrochloride |
| SMILES | CC(C)(C)c1ccc(N2CCC(NC(=O)CC(N)c3ccccc3)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C24H33N3O.2ClH/c1-24(2,3)19-9-11-21(12-10-19)27-15-13-20(14-16-27)26-23(28)17-22(25)18-7-5-4-6-8-18;;/h4-12,20,22H,13-17,25H2,1-3H3,(H,26,28);2*1H |
| InChIKey | CGMXWQONRVLTQL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |