C23H29N3O2 — CID 98215067
(5S,7S)-3-acetamido-N-[2-(1H-indol-3-yl)ethyl]adamantane-1-carboxamide (PubChem CID 98215067) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is (5S,7S)-3-acetamido-N-[2-(1H-indol-3-yl)ethyl]adamantane-1-carboxamide.
| Compound Name | (5S,7S)-3-acetamido-N-[2-(1H-indol-3-yl)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98215067 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | (5S,7S)-3-acetamido-N-[2-(1H-indol-3-yl)ethyl]adamantane-1-carboxamide |
| SMILES | CC(=O)NC12C[C@H]3C[C@H](C1)CC(C(=O)NCCc1c[nH]c4ccccc14)(C3)C2 |
| InChI | InChI=1S/C23H29N3O2/c1-15(27)26-23-11-16-8-17(12-23)10-22(9-16,14-23)21(28)24-7-6-18-13-25-20-5-3-2-4-19(18)20/h2-5,13,16-17,25H,6-12,14H2,1H3,(H,24,28)(H,26,27)/t16-,17-,22?,23?/m0/s1 |
| InChIKey | BQPIEZTVMVUNPW-PQJGELLGSA-N |
| XLogP | 3.30 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |