C23H32N2O2 — CID 130269489
3-(4-methoxyphenyl)-N-piperidin-4-yladamantane-1-carboxamide (PubChem CID 130269489) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-piperidin-4-yladamantane-1-carboxamide.
| Compound Name | 3-(4-methoxyphenyl)-N-piperidin-4-yladamantane-1-carboxamide |
|---|---|
| PubChem CID | 130269489 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-piperidin-4-yladamantane-1-carboxamide |
| SMILES | COc1ccc(C23CC4CC(CC(C(=O)NC5CCNCC5)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H32N2O2/c1-27-20-4-2-18(3-5-20)22-11-16-10-17(12-22)14-23(13-16,15-22)21(26)25-19-6-8-24-9-7-19/h2-5,16-17,19,24H,6-15H2,1H3,(H,25,26) |
| InChIKey | GOHOOKMVYXUDCI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |