C24H28N2O4 — CID 24536119
N'-[3-(4-methoxyphenyl)adamantane-1-carbonyl]-2-methylfuran-3-carbohydrazide (PubChem CID 24536119) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is N'-[3-(4-methoxyphenyl)adamantane-1-carbonyl]-2-methylfuran-3-carbohydrazide.
| Compound Name | N'-[3-(4-methoxyphenyl)adamantane-1-carbonyl]-2-methylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 24536119 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N'-[3-(4-methoxyphenyl)adamantane-1-carbonyl]-2-methylfuran-3-carbohydrazide |
| SMILES | COc1ccc(C23CC4CC(CC(C(=O)NNC(=O)c5ccoc5C)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C24H28N2O4/c1-15-20(7-8-30-15)21(27)25-26-22(28)24-12-16-9-17(13-24)11-23(10-16,14-24)18-3-5-19(29-2)6-4-18/h3-8,16-17H,9-14H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | RXQYKDUTXBNFII-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|