C15H19NOS — CID 13164829
3-thiophen-3-yladamantane-1-carboxamide (PubChem CID 13164829) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is 3-thiophen-3-yladamantane-1-carboxamide.
| Compound Name | 3-thiophen-3-yladamantane-1-carboxamide |
|---|---|
| PubChem CID | 13164829 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 3-thiophen-3-yladamantane-1-carboxamide |
| SMILES | NC(=O)C12CC3CC(C1)CC(c1ccsc1)(C3)C2 |
| InChI | InChI=1S/C15H19NOS/c16-13(17)15-6-10-3-11(7-15)5-14(4-10,9-15)12-1-2-18-8-12/h1-2,8,10-11H,3-7,9H2,(H2,16,17) |
| InChIKey | OVIPPTYPNLAWAA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |