C20H28F2O6S — CID 59839263
[3-[(2,2-difluoro-2-hydroperoxysulfanylacetyl)oxymethyl]-1-adamantyl] cyclohexanecarboxylate (PubChem CID 59839263) has the molecular formula C20H28F2O6S and a molecular weight of 434.50 g/mol. Its IUPAC name is [3-[(2,2-difluoro-2-hydroperoxysulfanylacetyl)oxymethyl]-1-adamantyl] cyclohexanecarboxylate.
| Compound Name | [3-[(2,2-difluoro-2-hydroperoxysulfanylacetyl)oxymethyl]-1-adamantyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 59839263 |
| Molecular Formula | C20H28F2O6S |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | [3-[(2,2-difluoro-2-hydroperoxysulfanylacetyl)oxymethyl]-1-adamantyl] cyclohexanecarboxylate |
| SMILES | O=C(OC12CC3CC(CC(COC(=O)C(F)(F)SOO)(C3)C1)C2)C1CCCCC1 |
| InChI | InChI=1S/C20H28F2O6S/c21-20(22,29-28-25)17(24)26-12-18-7-13-6-14(8-18)10-19(9-13,11-18)27-16(23)15-4-2-1-3-5-15/h13-15,25H,1-12H2 |
| InChIKey | RMUXTFMYQKULIH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|