C24H33F2O6S- — CID 59839367
[3-[(2,2-difluoro-2-oxidooxysulfanylacetyl)oxymethyl]-1-adamantyl] 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxylate (PubChem CID 59839367) has the molecular formula C24H33F2O6S- and a molecular weight of 487.59 g/mol. Its IUPAC name is [3-[(2,2-difluoro-2-oxidooxysulfanylacetyl)oxymethyl]-1-adamantyl] 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxylate.
| Compound Name | [3-[(2,2-difluoro-2-oxidooxysulfanylacetyl)oxymethyl]-1-adamantyl] 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 59839367 |
| Molecular Formula | C24H33F2O6S- |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | [3-[(2,2-difluoro-2-oxidooxysulfanylacetyl)oxymethyl]-1-adamantyl] 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxylate |
| SMILES | O=C(OC12CC3CC(CC(COC(=O)C(F)(F)SO[O-])(C3)C1)C2)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C24H34F2O6S/c25-24(26,33-32-29)21(28)30-14-22-9-15-7-16(10-22)12-23(11-15,13-22)31-20(27)19-6-5-17-3-1-2-4-18(17)8-19/h15-19,29H,1-14H2/p-1 |
| InChIKey | MKPHMVNPMACWPK-UHFFFAOYSA-M |
| XLogP | 4.55 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|