C24H40O8S2 — CID 134216516
1-[[3-[1-(2-methylsulfanylethoxycarbonyloxy)ethoxymethyl]-1-adamantyl]methoxy]ethyl 2-methylsulfanylethyl carbonate (PubChem CID 134216516) has the molecular formula C24H40O8S2 and a molecular weight of 520.71 g/mol. Its IUPAC name is 1-[[3-[1-(2-methylsulfanylethoxycarbonyloxy)ethoxymethyl]-1-adamantyl]methoxy]ethyl 2-methylsulfanylethyl carbonate.
| Compound Name | 1-[[3-[1-(2-methylsulfanylethoxycarbonyloxy)ethoxymethyl]-1-adamantyl]methoxy]ethyl 2-methylsulfanylethyl carbonate |
|---|---|
| PubChem CID | 134216516 |
| Molecular Formula | C24H40O8S2 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 1-[[3-[1-(2-methylsulfanylethoxycarbonyloxy)ethoxymethyl]-1-adamantyl]methoxy]ethyl 2-methylsulfanylethyl carbonate |
| SMILES | CSCCOC(=O)OC(C)OCC12CC3CC(C1)CC(COC(C)OC(=O)OCCSC)(C3)C2 |
| InChI | InChI=1S/C24H40O8S2/c1-17(31-21(25)27-5-7-33-3)29-15-23-10-19-9-20(11-23)13-24(12-19,14-23)16-30-18(2)32-22(26)28-6-8-34-4/h17-20H,5-16H2,1-4H3 |
| InChIKey | LSGUPPGDMVUXNA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|