C20H29O7S- — CID 58491402
2-[[3-[2-(2-methylprop-2-enoyloxy)propan-2-yl]-1-adamantyl]methoxy]-2-oxoethanesulfonate (PubChem CID 58491402) has the molecular formula C20H29O7S- and a molecular weight of 413.51 g/mol. Its IUPAC name is 2-[[3-[2-(2-methylprop-2-enoyloxy)propan-2-yl]-1-adamantyl]methoxy]-2-oxoethanesulfonate.
| Compound Name | 2-[[3-[2-(2-methylprop-2-enoyloxy)propan-2-yl]-1-adamantyl]methoxy]-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 58491402 |
| Molecular Formula | C20H29O7S- |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-[[3-[2-(2-methylprop-2-enoyloxy)propan-2-yl]-1-adamantyl]methoxy]-2-oxoethanesulfonate |
| SMILES | C=C(C)C(=O)OC(C)(C)C12CC3CC(CC(COC(=O)CS(=O)(=O)[O-])(C3)C1)C2 |
| InChI | InChI=1S/C20H30O7S/c1-13(2)17(22)27-18(3,4)20-8-14-5-15(9-20)7-19(6-14,11-20)12-26-16(21)10-28(23,24)25/h14-15H,1,5-12H2,2-4H3,(H,23,24,25)/p-1 |
| InChIKey | KUPXFFKYPBXHSR-UHFFFAOYSA-M |
| XLogP | 2.56 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|