C28H42O2 — CID 139934526
2-[3-[2-(1-adamantyl)ethyl]-1-adamantyl]propan-2-yl prop-2-enoate (PubChem CID 139934526) has the molecular formula C28H42O2 and a molecular weight of 410.64 g/mol. Its IUPAC name is 2-[3-[2-(1-adamantyl)ethyl]-1-adamantyl]propan-2-yl prop-2-enoate.
| Compound Name | 2-[3-[2-(1-adamantyl)ethyl]-1-adamantyl]propan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 139934526 |
| Molecular Formula | C28H42O2 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | 2-[3-[2-(1-adamantyl)ethyl]-1-adamantyl]propan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)(C)C12CC3CC(CC(CCC45CC6CC(CC(C6)C4)C5)(C3)C1)C2 |
| InChI | InChI=1S/C28H42O2/c1-4-24(29)30-25(2,3)28-16-22-10-23(17-28)15-27(14-22,18-28)6-5-26-11-19-7-20(12-26)9-21(8-19)13-26/h4,19-23H,1,5-18H2,2-3H3 |
| InChIKey | SGGNJOZPRKUOMY-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|