C28H42O3 — CID 139934531
[1-(1-adamantyl)-2-[3-(2-hydroxypropan-2-yl)-1-adamantyl]ethyl] prop-2-enoate (PubChem CID 139934531) has the molecular formula C28H42O3 and a molecular weight of 426.64 g/mol. Its IUPAC name is [1-(1-adamantyl)-2-[3-(2-hydroxypropan-2-yl)-1-adamantyl]ethyl] prop-2-enoate.
| Compound Name | [1-(1-adamantyl)-2-[3-(2-hydroxypropan-2-yl)-1-adamantyl]ethyl] prop-2-enoate |
|---|---|
| PubChem CID | 139934531 |
| Molecular Formula | C28H42O3 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | [1-(1-adamantyl)-2-[3-(2-hydroxypropan-2-yl)-1-adamantyl]ethyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(CC12CC3CC(C1)CC(C(C)(C)O)(C3)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H42O3/c1-4-24(29)31-23(27-11-18-5-19(12-27)7-20(6-18)13-27)16-26-9-21-8-22(10-26)15-28(14-21,17-26)25(2,3)30/h4,18-23,30H,1,5-17H2,2-3H3 |
| InChIKey | RLWWSCZXRKKCJF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|